Difference between revisions 6001772 and 6001773 on simplewiki{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 457631192 | ImageFileL1 = Ferrocene.svg | ImageSizeL1 = 80 px | ImageFileR1 = Ferrocene-from-xtal-3D-balls.png | ImageSizeR1 = 80 px | ImageFileL2 = Ferrocene 3d model 2.png | ImageFileR2 = Photo of Ferrocene (powdered).JPG | IUPACName = ferrocene, bis(''η''<sup>5</sup>-cyclopentadienyl)iron | OtherNames = dicyclopentadienyl iron |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 7329 | InChIKey = KTWOOEGAPBSYNW-UHFFFAOYAZ | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = KTWOOEGAPBSYNW-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 102-54-5 | PubChem = 11985121 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 30672 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = U96PKG90JQ | SMILES = [cH-]1cccc1.[cH-]1cccc1.[Fe+2] | Jmol = [cH-]1cccc1.[Fe+2].[cH-]1cccc1<!-- altered from SMILES to show correct -->⏎ | InChI = 1/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2 }} |Section2={{Chembox Properties | Formula = C<sub>10</sub>H<sub>10</sub>Fe | MolarMass = 186.04 g/mol | Appearance = light orange powder | Odor = [[camphor]]-like | Density = 1.107 g/cm<sup>3</sup> (0 °C), 1.490 g/cm<sup>3</sup> (20 °C)<ref>{{cite web|url=http://www.chemicalbook.com/ProductMSDSDetailCB1414721_EN.htm|title=Ferrocene(102-54-5)|accessdate=3 February 2010}}</ref> (contracted; show full) {{Authority control}} [[Category:Organoiron compounds]] [[Category:Metallocenes]] [[Category:Antiknock agents]] [[Category:Sandwich compounds]] [[Category:Cyclopentadienyl complexes]] All content in the above text box is licensed under the Creative Commons Attribution-ShareAlike license Version 4 and was originally sourced from https://simple.wikipedia.org/w/index.php?diff=prev&oldid=6001773.
![]() ![]() This site is not affiliated with or endorsed in any way by the Wikimedia Foundation or any of its affiliates. In fact, we fucking despise them.
|